Concept Explanation: Identifying Compound P via Ozonolysis

Ozonolysis is a reaction where alkenes are cleaved by ozone (O₃) to form carbonyl compounds (aldehydes or ketones). The products help deduce the structure of the original alkene.

Given the ozonolysis product of compound P is:

This is a diketone: 1-phenylbutane-1,4-dione. It indicates that compound P had two double bonds which, upon ozonolysis, gave two carbonyl groups per double bond.

Step-by-Step Reasoning:

Step 1: Analyze the product structure. The diketone has carbonyls at positions 1 and 4, with a phenyl group attached to carbon 1. So, the original alkene P must have had double bonds that would cleave to form these.

Step 2: Reverse the ozonolysis. For each carbonyl group in the product, imagine replacing the oxygen with a double bond to another carbon. Since it's a diketone, the original compound must be a diene.

Step 3: The product is symmetric? Actually, 1-phenylbutane-1,4-dione has two ketone groups. The left part (C1) has a phenyl group, and the right part (C4) is a methyl ketone. So, the original diene should have a phenyl-substituted double bond and another double bond.

Step 4: Check the options. We need a diene that upon ozonolysis gives exactly two molecules of the same carbonyl? But note: the product is a single molecule with two carbonyls. So, the original compound is a cyclic diene or a diene where the double bonds are in the same chain.

Looking at the options:

Option 1: (1,3-cyclohexadiene)

Option 2: (1,4-dimethyl-1,3-cyclohexadiene?) Actually, it looks like a substituted cyclohexadiene.

Option 3: (This is 1,2-dimethyl-1,3-cyclohexadiene? Hard to see exactly.)

Option 4: (This is 1,3-cyclopentadiene)

Step 5: Ozonolysis of cyclic dienes. For a cyclic diene, ozonolysis will cleave both double bonds, giving a dialdehyde or diketone. Specifically, 1,3-cyclohexadiene upon ozonolysis gives OHC-(CH2)2-CHO, which is succinaldehyde. But here we have a phenyl group, so it must be a substituted cyclic diene.

Option 2 has a phenyl group? Actually, looking at the image: it is 1-phenyl-1,3-cyclohexadiene. This is the correct one.

For 1-phenyl-1,3-cyclohexadiene, ozonolysis cleaves both double bonds. The cleavage at the phenyl-substituted double bond (C1=C2) would give benzaldehyde (PhCHO) and an aldehyde. But wait, it's cyclic: actually, it gives a diketone: specifically, it should give O=CH-CH2-CH2-CH2-C(=O)-Ph? But that is exactly 1-phenylbutane-1,4-dione? Let's see:

The structure of 1-phenyl-1,3-cyclohexadiene: the double bonds are between C1-C2 and C3-C4. Ozonolysis cleaves these, so the ring opens. The products would be O=CH- (from C1) attached to CH2-CH2-CHO? But actually, it gives O=CH-CH2-CH2-C(=O)-Ph. Yes, that is 1-phenylbutane-1,4-dione.

Final Answer: Compound P is the second option: (1-phenyl-1,3-cyclohexadiene).

Related Topics:

Ozonolysis mechanism
Dienes and their reactivity
Carbonyl compounds identification
Reverse synthesis using cleavage reactions

Formulae and Theory:

General ozonolysis reaction for alkenes:

R {CH}_{2} = C H R' \to R C H O + O = C H R'

For symmetric dienes, ozonolysis gives identical carbonyls. For unsymmetric, mixed products.

Cyclic alkenes give dialdehydes or diketones.